C12H12N2O4SZn — CID 70410928
2-(1,3-benzoxazol-2-ylsulfanyl)-4-(methylamino)-4-oxobutanoic acid;zinc (PubChem CID 70410928) has the molecular formula C12H12N2O4SZn and a molecular weight of 345.70 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-4-(methylamino)-4-oxobutanoic acid;zinc.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-4-(methylamino)-4-oxobutanoic acid;zinc |
|---|---|
| PubChem CID | 70410928 |
| Molecular Formula | C12H12N2O4SZn |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-4-(methylamino)-4-oxobutanoic acid;zinc |
| SMILES | CNC(=O)CC(Sc1nc2ccccc2o1)C(=O)O.[Zn] |
| InChI | InChI=1S/C12H12N2O4S.Zn/c1-13-10(15)6-9(11(16)17)19-12-14-7-4-2-3-5-8(7)18-12;/h2-5,9H,6H2,1H3,(H,13,15)(H,16,17); |
| InChIKey | JMYLLPLTVDIPPI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|