C13H13NO7S — CID 70459442
[1-(1,3-benzoxazol-2-ylsulfanyl)-1-carboxyoxybutan-2-yl] hydrogen carbonate (PubChem CID 70459442) has the molecular formula C13H13NO7S and a molecular weight of 327.31 g/mol. Its IUPAC name is [1-(1,3-benzoxazol-2-ylsulfanyl)-1-carboxyoxybutan-2-yl] hydrogen carbonate.
| Compound Name | [1-(1,3-benzoxazol-2-ylsulfanyl)-1-carboxyoxybutan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70459442 |
| Molecular Formula | C13H13NO7S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [1-(1,3-benzoxazol-2-ylsulfanyl)-1-carboxyoxybutan-2-yl] hydrogen carbonate |
| SMILES | CCC(OC(=O)O)C(OC(=O)O)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C13H13NO7S/c1-2-8(20-12(15)16)10(21-13(17)18)22-11-14-7-5-3-4-6-9(7)19-11/h3-6,8,10H,2H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | YYXQRNDGZXZRTP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|