C10H8ClNO3S — CID 3108359
3-(1,3-benzoxazol-2-ylsulfanyl)-2-chloropropanoic acid (PubChem CID 3108359) has the molecular formula C10H8ClNO3S and a molecular weight of 257.70 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-2-chloropropanoic acid.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-2-chloropropanoic acid |
|---|---|
| PubChem CID | 3108359 |
| Molecular Formula | C10H8ClNO3S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-2-chloropropanoic acid |
| SMILES | O=C(O)C(Cl)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H8ClNO3S/c11-6(9(13)14)5-16-10-12-7-3-1-2-4-8(7)15-10/h1-4,6H,5H2,(H,13,14) |
| InChIKey | UTWNACZGRSGSPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|