C21H15NO2S — CID 602357
2-(1,3-benzoxazol-2-ylsulfanyl)-1-(4-phenylphenyl)ethanone (PubChem CID 602357) has the molecular formula C21H15NO2S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 602357 |
| Molecular Formula | C21H15NO2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(4-phenylphenyl)ethanone |
| SMILES | O=C(CSc1nc2ccccc2o1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15NO2S/c23-19(14-25-21-22-18-8-4-5-9-20(18)24-21)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-13H,14H2 |
| InChIKey | XNSUSQOVMAXWQF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |