C19H16FN3O4S — CID 9471530
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-4-(4-fluorophenyl)-4-oxobutanehydrazide (PubChem CID 9471530) has the molecular formula C19H16FN3O4S and a molecular weight of 401.42 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-4-(4-fluorophenyl)-4-oxobutanehydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-4-(4-fluorophenyl)-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 9471530 |
| Molecular Formula | C19H16FN3O4S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-4-(4-fluorophenyl)-4-oxobutanehydrazide |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)NNC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C19H16FN3O4S/c20-13-7-5-12(6-8-13)15(24)9-10-17(25)22-23-18(26)11-28-19-21-14-3-1-2-4-16(14)27-19/h1-8H,9-11H2,(H,22,25)(H,23,26) |
| InChIKey | MHALGRCZIYYITI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|