C17H14ClN3O4S — CID 4811629
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(4-chlorophenoxy)acetohydrazide (PubChem CID 4811629) has the molecular formula C17H14ClN3O4S and a molecular weight of 391.84 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(4-chlorophenoxy)acetohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(4-chlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 4811629 |
| Molecular Formula | C17H14ClN3O4S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(4-chlorophenoxy)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1)NNC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C17H14ClN3O4S/c18-11-5-7-12(8-6-11)24-9-15(22)20-21-16(23)10-26-17-19-13-3-1-2-4-14(13)25-17/h1-8H,9-10H2,(H,20,22)(H,21,23) |
| InChIKey | TUCWGLYZGSSPGN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|