C20H21N3O4S — CID 9471387
N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2-propan-2-ylphenoxy)acetohydrazide (PubChem CID 9471387) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2-propan-2-ylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2-propan-2-ylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 9471387 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-2-(2-propan-2-ylphenoxy)acetohydrazide |
| SMILES | CC(C)c1ccccc1OCC(=O)NNC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C20H21N3O4S/c1-13(2)14-7-3-5-9-16(14)26-11-18(24)22-23-19(25)12-28-20-21-15-8-4-6-10-17(15)27-20/h3-10,13H,11-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | XXUHEMMUMZQFOE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|