C18H14ClN3O3S — CID 9471535
(E)-N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-(2-chlorophenyl)prop-2-enehydrazide (PubChem CID 9471535) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is (E)-N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-(2-chlorophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-(2-chlorophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9471535 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (E)-N'-[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]-3-(2-chlorophenyl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NNC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C18H14ClN3O3S/c19-13-6-2-1-5-12(13)9-10-16(23)21-22-17(24)11-26-18-20-14-7-3-4-8-15(14)25-18/h1-10H,11H2,(H,21,23)(H,22,24)/b10-9+ |
| InChIKey | FHOOPRZOMWWNSN-MDZDMXLPSA-N |
| XLogP | 3.43 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|