C16H11Cl2N3O2S — CID 1388822
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 1388822) has the molecular formula C16H11Cl2N3O2S and a molecular weight of 380.26 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1388822 |
| Molecular Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2N3O2S/c17-11-6-5-10(12(18)7-11)8-19-21-15(22)9-24-16-20-13-3-1-2-4-14(13)23-16/h1-8H,9H2,(H,21,22) |
| InChIKey | NPSODZYFGDJTNH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|