C24H17N3O2S — CID 6865246
N-[(E)-anthracen-9-ylmethylideneamino]-2-(1,3-benzoxazol-2-ylsulfanyl)acetamide (PubChem CID 6865246) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-2-(1,3-benzoxazol-2-ylsulfanyl)acetamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(1,3-benzoxazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 6865246 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(1,3-benzoxazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)N/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C24H17N3O2S/c28-23(15-30-24-26-21-11-5-6-12-22(21)29-24)27-25-14-20-18-9-3-1-7-16(18)13-17-8-2-4-10-19(17)20/h1-14H,15H2,(H,27,28)/b25-14+ |
| InChIKey | YRSJIMSXTYOQTN-AFUMVMLFSA-N |
| XLogP | 5.38 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|