C16H13FN4O2S2 — CID 9469319
1-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 9469319) has the molecular formula C16H13FN4O2S2 and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9469319 |
| Molecular Formula | C16H13FN4O2S2 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | O=C(CSc1nc2ccccc2o1)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN4O2S2/c17-10-5-7-11(8-6-10)18-15(24)21-20-14(22)9-25-16-19-12-3-1-2-4-13(12)23-16/h1-8H,9H2,(H,20,22)(H2,18,21,24) |
| InChIKey | LKJQWNBCZNWNDV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|