C15H13N5O2S2 — CID 10760923
1-[[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]-3-phenylthiourea (PubChem CID 10760923) has the molecular formula C15H13N5O2S2 and a molecular weight of 359.44 g/mol. Its IUPAC name is 1-[[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 10760923 |
| Molecular Formula | C15H13N5O2S2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-[[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]amino]-3-phenylthiourea |
| SMILES | O=C(CSc1nc2ncccc2o1)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C15H13N5O2S2/c21-12(19-20-14(23)17-10-5-2-1-3-6-10)9-24-15-18-13-11(22-15)7-4-8-16-13/h1-8H,9H2,(H,19,21)(H2,17,20,23) |
| InChIKey | HUIZTZYYHZRVPK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|