C24H32N6O4S4 — CID 139225718
1-[[2-[2-[2-[2-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]sulfanylethoxy]ethoxy]ethylsulfanyl]acetyl]amino]-3-phenylthiourea (PubChem CID 139225718) has the molecular formula C24H32N6O4S4 and a molecular weight of 596.83 g/mol. Its IUPAC name is 1-[[2-[2-[2-[2-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]sulfanylethoxy]ethoxy]ethylsulfanyl]acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-[2-[2-[2-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]sulfanylethoxy]ethoxy]ethylsulfanyl]acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 139225718 |
| Molecular Formula | C24H32N6O4S4 |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 1-[[2-[2-[2-[2-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]sulfanylethoxy]ethoxy]ethylsulfanyl]acetyl]amino]-3-phenylthiourea |
| SMILES | O=C(CSCCOCCOCCSCC(=O)NNC(=S)Nc1ccccc1)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C24H32N6O4S4/c31-21(27-29-23(35)25-19-7-3-1-4-8-19)17-37-15-13-33-11-12-34-14-16-38-18-22(32)28-30-24(36)26-20-9-5-2-6-10-20/h1-10H,11-18H2,(H,27,31)(H,28,32)(H2,25,29,35)(H2,26,30,36) |
| InChIKey | LDGYHGGFKSBWIP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|