C20H25N3OS2 — CID 17373026
1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 17373026) has the molecular formula C20H25N3OS2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 17373026 |
| Molecular Formula | C20H25N3OS2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | Cc1ccccc1CSCC(=O)NNC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H25N3OS2/c1-14(2)16-8-10-18(11-9-16)21-20(25)23-22-19(24)13-26-12-17-7-5-4-6-15(17)3/h4-11,14H,12-13H2,1-3H3,(H,22,24)(H2,21,23,25) |
| InChIKey | OXUDTILEMVWUQI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|