C24H27N3OS2 — CID 2728146
1-(4-butylphenyl)-3-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea (PubChem CID 2728146) has the molecular formula C24H27N3OS2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 2728146 |
| Molecular Formula | C24H27N3OS2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-(4-butylphenyl)-3-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)CSCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H27N3OS2/c1-2-3-7-18-12-14-21(15-13-18)25-24(29)27-26-23(28)17-30-16-20-10-6-9-19-8-4-5-11-22(19)20/h4-6,8-15H,2-3,7,16-17H2,1H3,(H,26,28)(H2,25,27,29) |
| InChIKey | PAHVOHUOQZDLGX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|