C20H24N4O3S — CID 8969854
2-[2-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzamide (PubChem CID 8969854) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[2-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 8969854 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[2-[2-[(4-butylphenyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzamide |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)COc2ccccc2C(N)=O)cc1 |
| InChI | InChI=1S/C20H24N4O3S/c1-2-3-6-14-9-11-15(12-10-14)22-20(28)24-23-18(25)13-27-17-8-5-4-7-16(17)19(21)26/h4-5,7-12H,2-3,6,13H2,1H3,(H2,21,26)(H,23,25)(H2,22,24,28) |
| InChIKey | GWOKZRJMJQGHET-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|