C21H24N4OS — CID 8017250
1-(4-butylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea (PubChem CID 8017250) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8017250 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H24N4OS/c1-3-4-7-15-10-12-16(13-11-15)22-21(27)24-23-20(26)18-14-25(2)19-9-6-5-8-17(18)19/h5-6,8-14H,3-4,7H2,1-2H3,(H,23,26)(H2,22,24,27) |
| InChIKey | QWHHPCRLAXCVRI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|