C20H20N4OS — CID 7988164
1-(4-ethylphenyl)-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea (PubChem CID 7988164) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 7988164 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea |
| SMILES | CCc1ccc(NC(=S)NNC(=O)c2ccccc2-n2cccc2)cc1 |
| InChI | InChI=1S/C20H20N4OS/c1-2-15-9-11-16(12-10-15)21-20(26)23-22-19(25)17-7-3-4-8-18(17)24-13-5-6-14-24/h3-14H,2H2,1H3,(H,22,25)(H2,21,23,26) |
| InChIKey | PCAMUWSVLUHGBM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|