C15H16N4OS — CID 4774855
1-cyclopropyl-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea (PubChem CID 4774855) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea.
| Compound Name | 1-cyclopropyl-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 4774855 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-cyclopropyl-3-[(2-pyrrol-1-ylbenzoyl)amino]thiourea |
| SMILES | O=C(NNC(=S)NC1CC1)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C15H16N4OS/c20-14(17-18-15(21)16-11-7-8-11)12-5-1-2-6-13(12)19-9-3-4-10-19/h1-6,9-11H,7-8H2,(H,17,20)(H2,16,18,21) |
| InChIKey | LFVMLAZFMHDBDI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|