C19H14F3N3O2 — CID 4807808
N'-(2-pyrrol-1-ylbenzoyl)-2-(trifluoromethyl)benzohydrazide (PubChem CID 4807808) has the molecular formula C19H14F3N3O2 and a molecular weight of 373.33 g/mol. Its IUPAC name is N'-(2-pyrrol-1-ylbenzoyl)-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(2-pyrrol-1-ylbenzoyl)-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 4807808 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N'-(2-pyrrol-1-ylbenzoyl)-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1C(F)(F)F)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C19H14F3N3O2/c20-19(21,22)15-9-3-1-7-13(15)17(26)23-24-18(27)14-8-2-4-10-16(14)25-11-5-6-12-25/h1-12H,(H,23,26)(H,24,27) |
| InChIKey | YZVLGSQHAHXFAF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|