C18H16N4O2S — CID 7996121
2-methylsulfanyl-N'-(2-pyrrol-1-ylbenzoyl)pyridine-3-carbohydrazide (PubChem CID 7996121) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-methylsulfanyl-N'-(2-pyrrol-1-ylbenzoyl)pyridine-3-carbohydrazide.
| Compound Name | 2-methylsulfanyl-N'-(2-pyrrol-1-ylbenzoyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 7996121 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-methylsulfanyl-N'-(2-pyrrol-1-ylbenzoyl)pyridine-3-carbohydrazide |
| SMILES | CSc1ncccc1C(=O)NNC(=O)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C18H16N4O2S/c1-25-18-14(8-6-10-19-18)17(24)21-20-16(23)13-7-2-3-9-15(13)22-11-4-5-12-22/h2-12H,1H3,(H,20,23)(H,21,24) |
| InChIKey | ZTHOGHNGSKBXLX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|