C10H14N2O2S — CID 83032320
N-[(2R)-2-hydroxypropyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 83032320) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 83032320 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)NC[C@@H](C)O |
| InChI | InChI=1S/C10H14N2O2S/c1-7(13)6-12-9(14)8-4-3-5-11-10(8)15-2/h3-5,7,13H,6H2,1-2H3,(H,12,14)/t7-/m1/s1 |
| InChIKey | WFFWTGZQOYHXAY-SSDOTTSWSA-N |
| XLogP | 0.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |