C10H12F2N2O3 — CID 166385426
2-(difluoromethoxy)-N-(2-hydroxypropyl)pyridine-3-carboxamide (PubChem CID 166385426) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-(2-hydroxypropyl)pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethoxy)-N-(2-hydroxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166385426 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-(difluoromethoxy)-N-(2-hydroxypropyl)pyridine-3-carboxamide |
| SMILES | CC(O)CNC(=O)c1cccnc1OC(F)F |
| InChI | InChI=1S/C10H12F2N2O3/c1-6(15)5-14-8(16)7-3-2-4-13-9(7)17-10(11)12/h2-4,6,10,15H,5H2,1H3,(H,14,16) |
| InChIKey | FPIKZUHMTBQUFU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |