C10H14N2O3S2 — CID 47230711
2-methylsulfanyl-N-(2-methylsulfonylethyl)pyridine-3-carboxamide (PubChem CID 47230711) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(2-methylsulfonylethyl)pyridine-3-carboxamide.
| Compound Name | 2-methylsulfanyl-N-(2-methylsulfonylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47230711 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-methylsulfanyl-N-(2-methylsulfonylethyl)pyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C10H14N2O3S2/c1-16-10-8(4-3-5-12-10)9(13)11-6-7-17(2,14)15/h3-5H,6-7H2,1-2H3,(H,11,13) |
| InChIKey | AFNPAIRAQOJHQS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |