C13H15F3N2O2 — CID 39951306
N'-(3-methylbutanoyl)-2-(trifluoromethyl)benzohydrazide (PubChem CID 39951306) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is N'-(3-methylbutanoyl)-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(3-methylbutanoyl)-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 39951306 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N'-(3-methylbutanoyl)-2-(trifluoromethyl)benzohydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O2/c1-8(2)7-11(19)17-18-12(20)9-5-3-4-6-10(9)13(14,15)16/h3-6,8H,7H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | FDWKSKOJHVZPOK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|