C18H20ClN3OS — CID 4873620
1-(4-butylphenyl)-3-[(4-chlorobenzoyl)amino]thiourea (PubChem CID 4873620) has the molecular formula C18H20ClN3OS and a molecular weight of 361.90 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(4-chlorobenzoyl)amino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(4-chlorobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 4873620 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(4-chlorobenzoyl)amino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H20ClN3OS/c1-2-3-4-13-5-11-16(12-6-13)20-18(24)22-21-17(23)14-7-9-15(19)10-8-14/h5-12H,2-4H2,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | PQOOQFAJMBYWBT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|