C20H26N4S2 — CID 8618159
1-(4-butylphenyl)-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea (PubChem CID 8618159) has the molecular formula C20H26N4S2 and a molecular weight of 386.59 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8618159 |
| Molecular Formula | C20H26N4S2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NNC(=S)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C20H26N4S2/c1-4-5-6-16-8-11-17(12-9-16)21-19(25)23-24-20(26)22-18-10-7-14(2)15(3)13-18/h7-13H,4-6H2,1-3H3,(H2,21,23,25)(H2,22,24,26) |
| InChIKey | NINDSAAOGZATEY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|