C14H23N5S2 — CID 8618167
1-[2-(dimethylamino)ethyl]-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea (PubChem CID 8618167) has the molecular formula C14H23N5S2 and a molecular weight of 325.51 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8618167 |
| Molecular Formula | C14H23N5S2 |
| Molecular Weight | 325.51 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[(3,4-dimethylphenyl)carbamothioylamino]thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=S)NCCN(C)C)cc1C |
| InChI | InChI=1S/C14H23N5S2/c1-10-5-6-12(9-11(10)2)16-14(21)18-17-13(20)15-7-8-19(3)4/h5-6,9H,7-8H2,1-4H3,(H2,15,17,20)(H2,16,18,21) |
| InChIKey | LXKOONCRZBIBGT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|