C11H16Cl2N4S — CID 8668618
1-(3,4-dichloroanilino)-3-[2-(dimethylamino)ethyl]thiourea (PubChem CID 8668618) has the molecular formula C11H16Cl2N4S and a molecular weight of 307.25 g/mol. Its IUPAC name is 1-(3,4-dichloroanilino)-3-[2-(dimethylamino)ethyl]thiourea.
| Compound Name | 1-(3,4-dichloroanilino)-3-[2-(dimethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 8668618 |
| Molecular Formula | C11H16Cl2N4S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 1-(3,4-dichloroanilino)-3-[2-(dimethylamino)ethyl]thiourea |
| SMILES | CN(C)CCNC(=S)NNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N4S/c1-17(2)6-5-14-11(18)16-15-8-3-4-9(12)10(13)7-8/h3-4,7,15H,5-6H2,1-2H3,(H2,14,16,18) |
| InChIKey | FAUJXRKIVKDXBE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|