C13H17Cl2N3S — CID 8668611
1-cyclohexyl-3-(3,4-dichloroanilino)thiourea (PubChem CID 8668611) has the molecular formula C13H17Cl2N3S and a molecular weight of 318.27 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dichloroanilino)thiourea.
| Compound Name | 1-cyclohexyl-3-(3,4-dichloroanilino)thiourea |
|---|---|
| PubChem CID | 8668611 |
| Molecular Formula | C13H17Cl2N3S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dichloroanilino)thiourea |
| SMILES | S=C(NNc1ccc(Cl)c(Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C13H17Cl2N3S/c14-11-7-6-10(8-12(11)15)17-18-13(19)16-9-4-2-1-3-5-9/h6-9,17H,1-5H2,(H2,16,18,19) |
| InChIKey | YJROWVZLQSCIHH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|