C13H14Cl2N2O2 — CID 2059042
N-cyclopentyl-N'-(3,4-dichlorophenyl)oxamide (PubChem CID 2059042) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is N-cyclopentyl-N'-(3,4-dichlorophenyl)oxamide.
| Compound Name | N-cyclopentyl-N'-(3,4-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 2059042 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-cyclopentyl-N'-(3,4-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C13H14Cl2N2O2/c14-10-6-5-9(7-11(10)15)17-13(19)12(18)16-8-3-1-2-4-8/h5-8H,1-4H2,(H,16,18)(H,17,19) |
| InChIKey | DYFLGPVPCDXZSJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|