C13H16N2O3 — CID 44995644
N-cyclopentyl-N'-(3-hydroxyphenyl)oxamide (PubChem CID 44995644) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-cyclopentyl-N'-(3-hydroxyphenyl)oxamide.
| Compound Name | N-cyclopentyl-N'-(3-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 44995644 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-cyclopentyl-N'-(3-hydroxyphenyl)oxamide |
| SMILES | O=C(Nc1cccc(O)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C13H16N2O3/c16-11-7-3-6-10(8-11)15-13(18)12(17)14-9-4-1-2-5-9/h3,6-9,16H,1-2,4-5H2,(H,14,17)(H,15,18) |
| InChIKey | TWFZDDNUFMBSHJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|