C16H21FN2O2 — CID 7585166
N-cycloheptyl-N'-(3-fluoro-4-methylphenyl)oxamide (PubChem CID 7585166) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is N-cycloheptyl-N'-(3-fluoro-4-methylphenyl)oxamide.
| Compound Name | N-cycloheptyl-N'-(3-fluoro-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 7585166 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-cycloheptyl-N'-(3-fluoro-4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC2CCCCCC2)cc1F |
| InChI | InChI=1S/C16H21FN2O2/c1-11-8-9-13(10-14(11)17)19-16(21)15(20)18-12-6-4-2-3-5-7-12/h8-10,12H,2-7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | VZSUKTLHMWZYDC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|