C13H19ClFN3O — CID 165429684
1-(3-fluoro-4-methylphenyl)-3-piperidin-4-ylurea;hydrochloride (PubChem CID 165429684) has the molecular formula C13H19ClFN3O and a molecular weight of 287.77 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-piperidin-4-ylurea;hydrochloride.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-piperidin-4-ylurea;hydrochloride |
|---|---|
| PubChem CID | 165429684 |
| Molecular Formula | C13H19ClFN3O |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-piperidin-4-ylurea;hydrochloride |
| SMILES | Cc1ccc(NC(=O)NC2CCNCC2)cc1F.Cl |
| InChI | InChI=1S/C13H18FN3O.ClH/c1-9-2-3-11(8-12(9)14)17-13(18)16-10-4-6-15-7-5-10;/h2-3,8,10,15H,4-7H2,1H3,(H2,16,17,18);1H |
| InChIKey | NLXKJNWWNMRRHB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |