C15H20FN3O3 — CID 86842324
methyl 4-[(3-fluoro-4-methylphenyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 86842324) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is methyl 4-[(3-fluoro-4-methylphenyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[(3-fluoro-4-methylphenyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86842324 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 4-[(3-fluoro-4-methylphenyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)Nc2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C15H20FN3O3/c1-10-3-4-12(9-13(10)16)18-14(20)17-11-5-7-19(8-6-11)15(21)22-2/h3-4,9,11H,5-8H2,1-2H3,(H2,17,18,20) |
| InChIKey | QOIMMILHJFSOHX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |