C16H22ClN3O4 — CID 108989901
ethyl 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 108989901) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is ethyl 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108989901 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethyl 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Nc2ccc(OC)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H22ClN3O4/c1-3-24-16(22)20-8-6-11(7-9-20)18-15(21)19-12-4-5-14(23-2)13(17)10-12/h4-5,10-11H,3,6-9H2,1-2H3,(H2,18,19,21) |
| InChIKey | JDOPWXNFQTVZAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |