C16H19ClF3N3O2S — CID 3279348
ethyl 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate (PubChem CID 3279348) has the molecular formula C16H19ClF3N3O2S and a molecular weight of 409.86 g/mol. Its IUPAC name is ethyl 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3279348 |
| Molecular Formula | C16H19ClF3N3O2S |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | ethyl 4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19ClF3N3O2S/c1-2-25-15(24)23-7-5-10(6-8-23)21-14(26)22-11-3-4-13(17)12(9-11)16(18,19)20/h3-4,9-10H,2,5-8H2,1H3,(H2,21,22,26) |
| InChIKey | UOWZWHNYMVFPIE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|