C15H21N3O3S — CID 15725102
ethyl 4-[(2-hydroxyphenyl)carbamothioylamino]piperidine-1-carboxylate (PubChem CID 15725102) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is ethyl 4-[(2-hydroxyphenyl)carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2-hydroxyphenyl)carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 15725102 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl 4-[(2-hydroxyphenyl)carbamothioylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=S)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C15H21N3O3S/c1-2-21-15(20)18-9-7-11(8-10-18)16-14(22)17-12-5-3-4-6-13(12)19/h3-6,11,19H,2,7-10H2,1H3,(H2,16,17,22) |
| InChIKey | OGSBRHXJCXCALZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|