C19H30N4O2S — CID 3592597
ethyl 4-[[4-(diethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate (PubChem CID 3592597) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is ethyl 4-[[4-(diethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(diethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3592597 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | ethyl 4-[[4-(diethylamino)phenyl]carbamothioylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=S)Nc2ccc(N(CC)CC)cc2)CC1 |
| InChI | InChI=1S/C19H30N4O2S/c1-4-22(5-2)17-9-7-15(8-10-17)20-18(26)21-16-11-13-23(14-12-16)19(24)25-6-3/h7-10,16H,4-6,11-14H2,1-3H3,(H2,20,21,26) |
| InChIKey | KOVMZHPUISMTFZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|