C15H20ClN3O2S — CID 3869393
ethyl 4-[(2-chlorophenyl)carbamothioylamino]piperidine-1-carboxylate (PubChem CID 3869393) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is ethyl 4-[(2-chlorophenyl)carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2-chlorophenyl)carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3869393 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | ethyl 4-[(2-chlorophenyl)carbamothioylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=S)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H20ClN3O2S/c1-2-21-15(20)19-9-7-11(8-10-19)17-14(22)18-13-6-4-3-5-12(13)16/h3-6,11H,2,7-10H2,1H3,(H2,17,18,22) |
| InChIKey | HZQBAVKYHBRDDI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|