C17H24ClN3O3 — CID 109028946
ethyl 4-[[3-(2-chloroanilino)-3-oxopropyl]amino]piperidine-1-carboxylate (PubChem CID 109028946) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is ethyl 4-[[3-(2-chloroanilino)-3-oxopropyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(2-chloroanilino)-3-oxopropyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109028946 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | ethyl 4-[[3-(2-chloroanilino)-3-oxopropyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-2-24-17(23)21-11-8-13(9-12-21)19-10-7-16(22)20-15-6-4-3-5-14(15)18/h3-6,13,19H,2,7-12H2,1H3,(H,20,22) |
| InChIKey | HZAPUKIKGSYNDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |