C18H25ClN4O4 — CID 9038050
ethyl 4-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]piperazine-1-carboxylate (PubChem CID 9038050) has the molecular formula C18H25ClN4O4 and a molecular weight of 396.88 g/mol. Its IUPAC name is ethyl 4-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 9038050 |
| Molecular Formula | C18H25ClN4O4 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | ethyl 4-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN(C)CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN4O4/c1-3-27-18(26)23-10-8-22(9-11-23)17(25)13-21(2)12-16(24)20-15-7-5-4-6-14(15)19/h4-7H,3,8-13H2,1-2H3,(H,20,24) |
| InChIKey | OFYAVDBXKHGWIJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |