C14H18ClN3O4 — CID 9036414
ethyl N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]carbamate (PubChem CID 9036414) has the molecular formula C14H18ClN3O4 and a molecular weight of 327.77 g/mol. Its IUPAC name is ethyl N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 9036414 |
| Molecular Formula | C14H18ClN3O4 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | ethyl N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(C)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN3O4/c1-3-22-14(21)17-13(20)9-18(2)8-12(19)16-11-7-5-4-6-10(11)15/h4-7H,3,8-9H2,1-2H3,(H,16,19)(H,17,20,21) |
| InChIKey | BJUGKUWVHQYSJT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |