C16H23ClN4O3 — CID 9036505
N-(2-chlorophenyl)-2-[methyl-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]amino]acetamide (PubChem CID 9036505) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[methyl-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[methyl-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 9036505 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(2-chlorophenyl)-2-[methyl-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]amino]acetamide |
| SMILES | CC(C)CNC(=O)NC(=O)CN(C)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN4O3/c1-11(2)8-18-16(24)20-15(23)10-21(3)9-14(22)19-13-7-5-4-6-12(13)17/h4-7,11H,8-10H2,1-3H3,(H,19,22)(H2,18,20,23,24) |
| InChIKey | HPOKFOQMLSDVFW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |