C17H16Cl2FN3O2 — CID 9037147
2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide (PubChem CID 9037147) has the molecular formula C17H16Cl2FN3O2 and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 9037147 |
| Molecular Formula | C17H16Cl2FN3O2 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-[[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-methylamino]-N-(2-chlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1cc(Cl)ccc1F)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H16Cl2FN3O2/c1-23(9-16(24)21-14-5-3-2-4-12(14)19)10-17(25)22-15-8-11(18)6-7-13(15)20/h2-8H,9-10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | NRJSRPTZDBEYGB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |