C17H25N3O5 — CID 8905214
ethyl N-[2-[[2-(2-ethoxyanilino)-2-oxoethyl]-ethylamino]acetyl]carbamate (PubChem CID 8905214) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is ethyl N-[2-[[2-(2-ethoxyanilino)-2-oxoethyl]-ethylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[2-(2-ethoxyanilino)-2-oxoethyl]-ethylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 8905214 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl N-[2-[[2-(2-ethoxyanilino)-2-oxoethyl]-ethylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)CC(=O)Nc1ccccc1OCC |
| InChI | InChI=1S/C17H25N3O5/c1-4-20(12-16(22)19-17(23)25-6-3)11-15(21)18-13-9-7-8-10-14(13)24-5-2/h7-10H,4-6,11-12H2,1-3H3,(H,18,21)(H,19,22,23) |
| InChIKey | AMWLFNJUPKWEGF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |