C19H29N3O4 — CID 8905335
ethyl N-[2-[ethyl-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]amino]acetyl]carbamate (PubChem CID 8905335) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl N-[2-[ethyl-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]amino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[ethyl-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]amino]acetyl]carbamate |
|---|---|
| PubChem CID | 8905335 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | ethyl N-[2-[ethyl-[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]amino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)CC(=O)Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C19H29N3O4/c1-6-22(12-17(24)21-19(25)26-7-2)11-16(23)20-18-14(5)9-8-10-15(18)13(3)4/h8-10,13H,6-7,11-12H2,1-5H3,(H,20,23)(H,21,24,25) |
| InChIKey | SNSPCMZMTVKADF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |