C23H32N2O — CID 8541792
2-[benzyl(ethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 8541792) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[benzyl(ethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 8541792 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1c(C(C)C)cccc1C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O/c1-6-25(15-19-11-8-7-9-12-19)16-22(26)24-23-20(17(2)3)13-10-14-21(23)18(4)5/h7-14,17-18H,6,15-16H2,1-5H3,(H,24,26) |
| InChIKey | VMTGHPSBKHNTQP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |