C24H30N2O3 — CID 46614486
2-[bis(furan-2-ylmethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 46614486) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[bis(furan-2-ylmethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[bis(furan-2-ylmethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 46614486 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[bis(furan-2-ylmethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CN(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C24H30N2O3/c1-17(2)21-10-5-11-22(18(3)4)24(21)25-23(27)16-26(14-19-8-6-12-28-19)15-20-9-7-13-29-20/h5-13,17-18H,14-16H2,1-4H3,(H,25,27) |
| InChIKey | FHEBDEJMJFRTEZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |