C28H30N2O3 — CID 19874929
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-(9H-fluoren-9-yl)carbamic acid (PubChem CID 19874929) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-(9H-fluoren-9-yl)carbamic acid.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-(9H-fluoren-9-yl)carbamic acid |
|---|---|
| PubChem CID | 19874929 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-(9H-fluoren-9-yl)carbamic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CN(C(=O)O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H30N2O3/c1-17(2)19-14-9-15-20(18(3)4)26(19)29-25(31)16-30(28(32)33)27-23-12-7-5-10-21(23)22-11-6-8-13-24(22)27/h5-15,17-18,27H,16H2,1-4H3,(H,29,31)(H,32,33) |
| InChIKey | VOOXHFCNMQYNSM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |